C9H10N4OS — CID 82220778
5-propyl-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde (PubChem CID 82220778) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 5-propyl-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde.
| Compound Name | 5-propyl-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82220778 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 5-propyl-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde |
| SMILES | CCCc1c(C=O)nnn1-c1nccs1 |
| InChI | InChI=1S/C9H10N4OS/c1-2-3-8-7(6-14)11-12-13(8)9-10-4-5-15-9/h4-6H,2-3H2,1H3 |
| InChIKey | MOHXEPAPZOUCQA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|