C7H9N5O2S2 — CID 82220973
5-ethylsulfonyl-3-(1,3-thiazol-2-yl)triazol-4-amine (PubChem CID 82220973) has the molecular formula C7H9N5O2S2 and a molecular weight of 259.32 g/mol. Its IUPAC name is 5-ethylsulfonyl-3-(1,3-thiazol-2-yl)triazol-4-amine.
| Compound Name | 5-ethylsulfonyl-3-(1,3-thiazol-2-yl)triazol-4-amine |
|---|---|
| PubChem CID | 82220973 |
| Molecular Formula | C7H9N5O2S2 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 5-ethylsulfonyl-3-(1,3-thiazol-2-yl)triazol-4-amine |
| SMILES | CCS(=O)(=O)c1nnn(-c2nccs2)c1N |
| InChI | InChI=1S/C7H9N5O2S2/c1-2-16(13,14)6-5(8)12(11-10-6)7-9-3-4-15-7/h3-4H,2,8H2,1H3 |
| InChIKey | YMXJXOWXNUOFQI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |