C11H20N4O2S2 — CID 86914969
N,N-diethyl-4-(1,3-thiazol-2-yl)piperazine-1-sulfonamide (PubChem CID 86914969) has the molecular formula C11H20N4O2S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N,N-diethyl-4-(1,3-thiazol-2-yl)piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-(1,3-thiazol-2-yl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 86914969 |
| Molecular Formula | C11H20N4O2S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N,N-diethyl-4-(1,3-thiazol-2-yl)piperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C11H20N4O2S2/c1-3-14(4-2)19(16,17)15-8-6-13(7-9-15)11-12-5-10-18-11/h5,10H,3-4,6-9H2,1-2H3 |
| InChIKey | BEOVEKFBSBYKKL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |