C15H14N4O2S — CID 94962579
5-[(3-ethylphenoxy)methyl]-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde (PubChem CID 94962579) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 5-[(3-ethylphenoxy)methyl]-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde.
| Compound Name | 5-[(3-ethylphenoxy)methyl]-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 94962579 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 5-[(3-ethylphenoxy)methyl]-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde |
| SMILES | CCc1cccc(OCc2c(C=O)nnn2-c2nccs2)c1 |
| InChI | InChI=1S/C15H14N4O2S/c1-2-11-4-3-5-12(8-11)21-10-14-13(9-20)17-18-19(14)15-16-6-7-22-15/h3-9H,2,10H2,1H3 |
| InChIKey | COAXGQJBTFXYSW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|