C13H10N4O2S — CID 82220861
5-(phenoxymethyl)-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde (PubChem CID 82220861) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 5-(phenoxymethyl)-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde.
| Compound Name | 5-(phenoxymethyl)-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82220861 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-(phenoxymethyl)-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde |
| SMILES | O=Cc1nnn(-c2nccs2)c1COc1ccccc1 |
| InChI | InChI=1S/C13H10N4O2S/c18-8-11-12(9-19-10-4-2-1-3-5-10)17(16-15-11)13-14-6-7-20-13/h1-8H,9H2 |
| InChIKey | VTBLUAIHWJKRSB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|