C11H11Cl2FN2O — CID 107579725
3-amino-1-(3,5-dichloro-4-fluorophenyl)piperidin-2-one (PubChem CID 107579725) has the molecular formula C11H11Cl2FN2O and a molecular weight of 277.13 g/mol. Its IUPAC name is 3-amino-1-(3,5-dichloro-4-fluorophenyl)piperidin-2-one.
| Compound Name | 3-amino-1-(3,5-dichloro-4-fluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 107579725 |
| Molecular Formula | C11H11Cl2FN2O |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 3-amino-1-(3,5-dichloro-4-fluorophenyl)piperidin-2-one |
| SMILES | NC1CCCN(c2cc(Cl)c(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C11H11Cl2FN2O/c12-7-4-6(5-8(13)10(7)14)16-3-1-2-9(15)11(16)17/h4-5,9H,1-3,15H2 |
| InChIKey | XONCVPWYZMRZKQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|