C14H15Cl2FN2O — CID 107579720
3-(cyclopropylamino)-1-(3,5-dichloro-4-fluorophenyl)piperidin-2-one (PubChem CID 107579720) has the molecular formula C14H15Cl2FN2O and a molecular weight of 317.19 g/mol. Its IUPAC name is 3-(cyclopropylamino)-1-(3,5-dichloro-4-fluorophenyl)piperidin-2-one.
| Compound Name | 3-(cyclopropylamino)-1-(3,5-dichloro-4-fluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 107579720 |
| Molecular Formula | C14H15Cl2FN2O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-(cyclopropylamino)-1-(3,5-dichloro-4-fluorophenyl)piperidin-2-one |
| SMILES | O=C1C(NC2CC2)CCCN1c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2FN2O/c15-10-6-9(7-11(16)13(10)17)19-5-1-2-12(14(19)20)18-8-3-4-8/h6-8,12,18H,1-5H2 |
| InChIKey | GRPMJPLYRSJOJY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|