C15H16Br2N2 — CID 107582913
N-(3-bromo-5-methylphenyl)-1-(4-bromophenyl)ethane-1,2-diamine (PubChem CID 107582913) has the molecular formula C15H16Br2N2 and a molecular weight of 384.12 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-1-(4-bromophenyl)ethane-1,2-diamine.
| Compound Name | N-(3-bromo-5-methylphenyl)-1-(4-bromophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107582913 |
| Molecular Formula | C15H16Br2N2 |
| Molecular Weight | 384.12 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-1-(4-bromophenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(Br)cc(NC(CN)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C15H16Br2N2/c1-10-6-13(17)8-14(7-10)19-15(9-18)11-2-4-12(16)5-3-11/h2-8,15,19H,9,18H2,1H3 |
| InChIKey | GTPOCMKVVSKYMM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.12 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |