C19H23NO2Si — CID 10758450
(2S,5S)-2,5-diphenyl-3-(trimethylsilylmethyl)-1,3-oxazolidin-4-one (PubChem CID 10758450) has the molecular formula C19H23NO2Si and a molecular weight of 325.48 g/mol. Its IUPAC name is (2S,5S)-2,5-diphenyl-3-(trimethylsilylmethyl)-1,3-oxazolidin-4-one.
| Compound Name | (2S,5S)-2,5-diphenyl-3-(trimethylsilylmethyl)-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 10758450 |
| Molecular Formula | C19H23NO2Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (2S,5S)-2,5-diphenyl-3-(trimethylsilylmethyl)-1,3-oxazolidin-4-one |
| SMILES | C[Si](C)(C)CN1C(=O)[C@H](c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H23NO2Si/c1-23(2,3)14-20-18(21)17(15-10-6-4-7-11-15)22-19(20)16-12-8-5-9-13-16/h4-13,17,19H,14H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | LWARRZSEOJUQKP-HKUYNNGSSA-N |
| XLogP | 4.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|