C14H20N4O3 — CID 107586068
3-[4-[(5-methyl-3-pyridinyl)carbamoyl]piperazin-1-yl]propanoic acid (PubChem CID 107586068) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-[4-[(5-methyl-3-pyridinyl)carbamoyl]piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-[(5-methyl-3-pyridinyl)carbamoyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 107586068 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-[4-[(5-methyl-3-pyridinyl)carbamoyl]piperazin-1-yl]propanoic acid |
| SMILES | Cc1cncc(NC(=O)N2CCN(CCC(=O)O)CC2)c1 |
| InChI | InChI=1S/C14H20N4O3/c1-11-8-12(10-15-9-11)16-14(21)18-6-4-17(5-7-18)3-2-13(19)20/h8-10H,2-7H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | CAKRMCXLGHGCLX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |