C10H15N3O — CID 107587633
2,2-dimethyl-3-(pyrimidin-5-ylamino)cyclobutan-1-ol (PubChem CID 107587633) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2,2-dimethyl-3-(pyrimidin-5-ylamino)cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-(pyrimidin-5-ylamino)cyclobutan-1-ol |
|---|---|
| PubChem CID | 107587633 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2,2-dimethyl-3-(pyrimidin-5-ylamino)cyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Nc1cncnc1 |
| InChI | InChI=1S/C10H15N3O/c1-10(2)8(3-9(10)14)13-7-4-11-6-12-5-7/h4-6,8-9,13-14H,3H2,1-2H3 |
| InChIKey | FCZXZJQPDZFVKP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |