C10H17N5O — CID 114633026
3-[(6-hydrazinylpyrazin-2-yl)amino]-2,2-dimethylcyclobutan-1-ol (PubChem CID 114633026) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-[(6-hydrazinylpyrazin-2-yl)amino]-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-[(6-hydrazinylpyrazin-2-yl)amino]-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 114633026 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-[(6-hydrazinylpyrazin-2-yl)amino]-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Nc1cncc(NN)n1 |
| InChI | InChI=1S/C10H17N5O/c1-10(2)6(3-7(10)16)13-8-4-12-5-9(14-8)15-11/h4-7,16H,3,11H2,1-2H3,(H2,13,14,15) |
| InChIKey | CHFGXMIVQAKLHC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|