C11H13N3S — CID 107587733
N-[(2,5-dimethylthiophen-3-yl)methyl]pyrimidin-5-amine (PubChem CID 107587733) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-[(2,5-dimethylthiophen-3-yl)methyl]pyrimidin-5-amine.
| Compound Name | N-[(2,5-dimethylthiophen-3-yl)methyl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 107587733 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-[(2,5-dimethylthiophen-3-yl)methyl]pyrimidin-5-amine |
| SMILES | Cc1cc(CNc2cncnc2)c(C)s1 |
| InChI | InChI=1S/C11H13N3S/c1-8-3-10(9(2)15-8)4-14-11-5-12-7-13-6-11/h3,5-7,14H,4H2,1-2H3 |
| InChIKey | VWYIJEIPWVUGHS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |