C9H15NOS — CID 78975145
1-(2,5-dimethylthiophen-3-yl)-N-ethoxymethanamine (PubChem CID 78975145) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-N-ethoxymethanamine.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-N-ethoxymethanamine |
|---|---|
| PubChem CID | 78975145 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-N-ethoxymethanamine |
| SMILES | CCONCc1cc(C)sc1C |
| InChI | InChI=1S/C9H15NOS/c1-4-11-10-6-9-5-7(2)12-8(9)3/h5,10H,4,6H2,1-3H3 |
| InChIKey | SJDQMQYAOGBRCG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|