C16H19NO2S — CID 63423353
ethyl 2-[(2,5-dimethylthiophen-3-yl)methylamino]benzoate (PubChem CID 63423353) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is ethyl 2-[(2,5-dimethylthiophen-3-yl)methylamino]benzoate.
| Compound Name | ethyl 2-[(2,5-dimethylthiophen-3-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 63423353 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | ethyl 2-[(2,5-dimethylthiophen-3-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NCc1cc(C)sc1C |
| InChI | InChI=1S/C16H19NO2S/c1-4-19-16(18)14-7-5-6-8-15(14)17-10-13-9-11(2)20-12(13)3/h5-9,17H,4,10H2,1-3H3 |
| InChIKey | LEVYJKCAGVGERT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |