C19H16F2O3 — CID 10758776
benzyl (2Z)-2-[(3,4-difluorophenyl)methylidene]-3-oxopentanoate (PubChem CID 10758776) has the molecular formula C19H16F2O3 and a molecular weight of 330.33 g/mol. Its IUPAC name is benzyl (2Z)-2-[(3,4-difluorophenyl)methylidene]-3-oxopentanoate.
| Compound Name | benzyl (2Z)-2-[(3,4-difluorophenyl)methylidene]-3-oxopentanoate |
|---|---|
| PubChem CID | 10758776 |
| Molecular Formula | C19H16F2O3 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | benzyl (2Z)-2-[(3,4-difluorophenyl)methylidene]-3-oxopentanoate |
| SMILES | CCC(=O)/C(=C/c1ccc(F)c(F)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H16F2O3/c1-2-18(22)15(10-14-8-9-16(20)17(21)11-14)19(23)24-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3/b15-10- |
| InChIKey | MZRPLZAXASBKJF-GDNBJRDFSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|