C32H24CaO6 — CID 6916902
calcium;(Z,2Z)-2-benzylidene-4-phenyl-3-phenylmethoxycarbonylbut-3-enoate;benzoate (PubChem CID 6916902) has the molecular formula C32H24CaO6 and a molecular weight of 544.62 g/mol. Its IUPAC name is calcium;(Z,2Z)-2-benzylidene-4-phenyl-3-phenylmethoxycarbonylbut-3-enoate;benzoate.
| Compound Name | calcium;(Z,2Z)-2-benzylidene-4-phenyl-3-phenylmethoxycarbonylbut-3-enoate;benzoate |
|---|---|
| PubChem CID | 6916902 |
| Molecular Formula | C32H24CaO6 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | calcium;(Z,2Z)-2-benzylidene-4-phenyl-3-phenylmethoxycarbonylbut-3-enoate;benzoate |
| SMILES | O=C([O-])C(=C\c1ccccc1)/C(=C/c1ccccc1)C(=O)OCc1ccccc1.O=C([O-])c1ccccc1.[Ca+2] |
| InChI | InChI=1S/C25H20O4.C7H6O2.Ca/c26-24(27)22(16-19-10-4-1-5-11-19)23(17-20-12-6-2-7-13-20)25(28)29-18-21-14-8-3-9-15-21;8-7(9)6-4-2-1-3-5-6;/h1-17H,18H2,(H,26,27);1-5H,(H,8,9);/q;;+2/p-2/b22-16-,23-17-;; |
| InChIKey | YVFZWQNSTMJGKP-PBINIOGQSA-L |
| XLogP | 3.32 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|