C21H18O — CID 134952285
[(Z)-1,2-diphenylethenoxy]methylbenzene (PubChem CID 134952285) has the molecular formula C21H18O and a molecular weight of 286.37 g/mol. Its IUPAC name is [(Z)-1,2-diphenylethenoxy]methylbenzene.
| Compound Name | [(Z)-1,2-diphenylethenoxy]methylbenzene |
|---|---|
| PubChem CID | 134952285 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(Z)-1,2-diphenylethenoxy]methylbenzene |
| SMILES | C(=C(\OCc1ccccc1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C21H18O/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)22-17-19-12-6-2-7-13-19/h1-16H,17H2/b21-16- |
| InChIKey | SYUDAPIZZXHBOB-PGMHBOJBSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|