About 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine
4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine (PubChem CID 57213266) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine |
| PubChem CID | 57213266 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCOC(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO/c1-21(2)15-9-10-16-22-20(19-13-7-4-8-14-19)17-18-11-5-3-6-12-18/h3-8,11-14,17H,9-10,15-16H2,1-2H3 |
| InChIKey | SCHSDSSWARKHHO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine?
The IUPAC name of 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine (CID 57213266) is 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine.
What is the SMILES notation for 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine?
The canonical SMILES for 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine is CN(C)CCCCOC(=Cc1ccccc1)c1ccccc1.
What is the InChIKey of 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine?
The InChIKey is SCHSDSSWARKHHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO/c1-21(2)15-9-10-16-22-20(19-13-7-4-8-14-19)17-18-11-5-3-6-12-18/h3-8,11-14,17H,9-10,15-16H2,1-2H3.
What are the key properties of 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine?
4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine has a molecular weight of 295.43 g/mol, XLogP of 4.54, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-diphenylethenoxy)-N,N-dimethylbutan-1-amine is sourced from PubChem (CID 57213266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).