About tribromo-[(Z)-1,2-diphenylethenoxy]germane
tribromo-[(Z)-1,2-diphenylethenoxy]germane (PubChem CID 132573464) has the molecular formula C14H11Br3GeO
and a molecular weight of 507.56 g/mol. Its IUPAC name is tribromo-[(Z)-1,2-diphenylethenoxy]germane.
Molecular Properties
| Compound Name | tribromo-[(Z)-1,2-diphenylethenoxy]germane |
| PubChem CID | 132573464 |
| Molecular Formula | C14H11Br3GeO |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 505.76 |
| IUPAC Name | tribromo-[(Z)-1,2-diphenylethenoxy]germane |
| SMILES | Br[Ge](Br)(Br)O/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H11Br3GeO/c15-18(16,17)19-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H/b14-11- |
| InChIKey | GLHKGVSFZIBZBW-KAMYIIQDSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze tribromo-[(Z)-1,2-diphenylethenoxy]germane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribromo-[(Z)-1,2-diphenylethenoxy]germane?
The IUPAC name of tribromo-[(Z)-1,2-diphenylethenoxy]germane (CID 132573464) is tribromo-[(Z)-1,2-diphenylethenoxy]germane.
What is the SMILES notation for tribromo-[(Z)-1,2-diphenylethenoxy]germane?
The canonical SMILES for tribromo-[(Z)-1,2-diphenylethenoxy]germane is Br[Ge](Br)(Br)O/C(=C\c1ccccc1)c1ccccc1.
What is the InChIKey of tribromo-[(Z)-1,2-diphenylethenoxy]germane?
The InChIKey is GLHKGVSFZIBZBW-KAMYIIQDSA-N. The full InChI is InChI=1S/C14H11Br3GeO/c15-18(16,17)19-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H/b14-11-.
What are the key properties of tribromo-[(Z)-1,2-diphenylethenoxy]germane?
tribromo-[(Z)-1,2-diphenylethenoxy]germane has a molecular weight of 507.56 g/mol, XLogP of 5.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tribromo-[(Z)-1,2-diphenylethenoxy]germane is sourced from PubChem (CID 132573464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).