C18H23NO5 — CID 10759057
methyl (2S,3R,5S,6S)-3-hydroxy-3,4,4-trimethyl-7-oxo-6-phenylmethoxy-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 10759057) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is methyl (2S,3R,5S,6S)-3-hydroxy-3,4,4-trimethyl-7-oxo-6-phenylmethoxy-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | methyl (2S,3R,5S,6S)-3-hydroxy-3,4,4-trimethyl-7-oxo-6-phenylmethoxy-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10759057 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | methyl (2S,3R,5S,6S)-3-hydroxy-3,4,4-trimethyl-7-oxo-6-phenylmethoxy-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)[C@H]1N2C(=O)[C@@H](OCc3ccccc3)[C@@H]2C(C)(C)[C@@]1(C)O |
| InChI | InChI=1S/C18H23NO5/c1-17(2)13-12(24-10-11-8-6-5-7-9-11)15(20)19(13)14(16(21)23-4)18(17,3)22/h5-9,12-14,22H,10H2,1-4H3/t12-,13+,14+,18-/m0/s1 |
| InChIKey | GCMXIPMHUNWFDB-LWGWVAHUSA-N |
| XLogP | 1.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |