C14H16BrFN2O2 — CID 107591763
3-(5-bromo-4-fluoro-2-methylanilino)-1-propylpyrrolidine-2,5-dione (PubChem CID 107591763) has the molecular formula C14H16BrFN2O2 and a molecular weight of 343.20 g/mol. Its IUPAC name is 3-(5-bromo-4-fluoro-2-methylanilino)-1-propylpyrrolidine-2,5-dione.
| Compound Name | 3-(5-bromo-4-fluoro-2-methylanilino)-1-propylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 107591763 |
| Molecular Formula | C14H16BrFN2O2 |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-(5-bromo-4-fluoro-2-methylanilino)-1-propylpyrrolidine-2,5-dione |
| SMILES | CCCN1C(=O)CC(Nc2cc(Br)c(F)cc2C)C1=O |
| InChI | InChI=1S/C14H16BrFN2O2/c1-3-4-18-13(19)7-12(14(18)20)17-11-6-9(15)10(16)5-8(11)2/h5-6,12,17H,3-4,7H2,1-2H3 |
| InChIKey | CRFREAADVUETGD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|