C13H16BrFN2O2 — CID 107592357
4-amino-N-(5-bromo-4-fluoro-2-methylphenyl)-3-methyloxolane-3-carboxamide (PubChem CID 107592357) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is 4-amino-N-(5-bromo-4-fluoro-2-methylphenyl)-3-methyloxolane-3-carboxamide.
| Compound Name | 4-amino-N-(5-bromo-4-fluoro-2-methylphenyl)-3-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 107592357 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-amino-N-(5-bromo-4-fluoro-2-methylphenyl)-3-methyloxolane-3-carboxamide |
| SMILES | Cc1cc(F)c(Br)cc1NC(=O)C1(C)COCC1N |
| InChI | InChI=1S/C13H16BrFN2O2/c1-7-3-9(15)8(14)4-10(7)17-12(18)13(2)6-19-5-11(13)16/h3-4,11H,5-6,16H2,1-2H3,(H,17,18) |
| InChIKey | MIVDYUUYYRDFLG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |