C13H13BrFN — CID 107592754
1-(5-bromo-4-fluoro-2-methylphenyl)-2,5-dimethylpyrrole (PubChem CID 107592754) has the molecular formula C13H13BrFN and a molecular weight of 282.16 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methylphenyl)-2,5-dimethylpyrrole.
| Compound Name | 1-(5-bromo-4-fluoro-2-methylphenyl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 107592754 |
| Molecular Formula | C13H13BrFN |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methylphenyl)-2,5-dimethylpyrrole |
| SMILES | Cc1cc(F)c(Br)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C13H13BrFN/c1-8-6-12(15)11(14)7-13(8)16-9(2)4-5-10(16)3/h4-7H,1-3H3 |
| InChIKey | DMPXNXXSFXDKLK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|