C12H15BrFNO2 — CID 107592763
1-(5-bromo-4-fluoro-2-methylphenyl)-3,3-dimethoxyazetidine (PubChem CID 107592763) has the molecular formula C12H15BrFNO2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methylphenyl)-3,3-dimethoxyazetidine.
| Compound Name | 1-(5-bromo-4-fluoro-2-methylphenyl)-3,3-dimethoxyazetidine |
|---|---|
| PubChem CID | 107592763 |
| Molecular Formula | C12H15BrFNO2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methylphenyl)-3,3-dimethoxyazetidine |
| SMILES | COC1(OC)CN(c2cc(Br)c(F)cc2C)C1 |
| InChI | InChI=1S/C12H15BrFNO2/c1-8-4-10(14)9(13)5-11(8)15-6-12(7-15,16-2)17-3/h4-5H,6-7H2,1-3H3 |
| InChIKey | OTKDGMISLPNAJB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|