C9H10FN3OS — CID 107595138
3-amino-N-(3-fluoro-4-pyridinyl)-2-methyl-3-sulfanylidenepropanamide (PubChem CID 107595138) has the molecular formula C9H10FN3OS and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-amino-N-(3-fluoro-4-pyridinyl)-2-methyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(3-fluoro-4-pyridinyl)-2-methyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 107595138 |
| Molecular Formula | C9H10FN3OS |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 3-amino-N-(3-fluoro-4-pyridinyl)-2-methyl-3-sulfanylidenepropanamide |
| SMILES | CC(C(=O)Nc1ccncc1F)C(N)=S |
| InChI | InChI=1S/C9H10FN3OS/c1-5(8(11)15)9(14)13-7-2-3-12-4-6(7)10/h2-5H,1H3,(H2,11,15)(H,12,13,14) |
| InChIKey | IVTPVRXHZONAKK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|