C10H14FN3O2 — CID 75522495
1-(3-fluoro-4-pyridinyl)-3-(3-hydroxybutyl)urea (PubChem CID 75522495) has the molecular formula C10H14FN3O2 and a molecular weight of 227.24 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-3-(3-hydroxybutyl)urea.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-3-(3-hydroxybutyl)urea |
|---|---|
| PubChem CID | 75522495 |
| Molecular Formula | C10H14FN3O2 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-3-(3-hydroxybutyl)urea |
| SMILES | CC(O)CCNC(=O)Nc1ccncc1F |
| InChI | InChI=1S/C10H14FN3O2/c1-7(15)2-5-13-10(16)14-9-3-4-12-6-8(9)11/h3-4,6-7,15H,2,5H2,1H3,(H2,12,13,14,16) |
| InChIKey | GDUAPQNMUBZPBB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |