C13H12ClFN4O — CID 107595523
2-chloro-6-(ethylamino)-N-(3-fluoro-4-pyridinyl)pyridine-4-carboxamide (PubChem CID 107595523) has the molecular formula C13H12ClFN4O and a molecular weight of 294.72 g/mol. Its IUPAC name is 2-chloro-6-(ethylamino)-N-(3-fluoro-4-pyridinyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(ethylamino)-N-(3-fluoro-4-pyridinyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 107595523 |
| Molecular Formula | C13H12ClFN4O |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-chloro-6-(ethylamino)-N-(3-fluoro-4-pyridinyl)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)Nc2ccncc2F)cc(Cl)n1 |
| InChI | InChI=1S/C13H12ClFN4O/c1-2-17-12-6-8(5-11(14)19-12)13(20)18-10-3-4-16-7-9(10)15/h3-7H,2H2,1H3,(H,17,19)(H,16,18,20) |
| InChIKey | WGXYJDYAVSDBCL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|