C12H12ClN5O — CID 55047218
2-chloro-6-(ethylamino)-N-pyrazin-2-ylpyridine-4-carboxamide (PubChem CID 55047218) has the molecular formula C12H12ClN5O and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-chloro-6-(ethylamino)-N-pyrazin-2-ylpyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(ethylamino)-N-pyrazin-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 55047218 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-chloro-6-(ethylamino)-N-pyrazin-2-ylpyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)Nc2cnccn2)cc(Cl)n1 |
| InChI | InChI=1S/C12H12ClN5O/c1-2-15-10-6-8(5-9(13)17-10)12(19)18-11-7-14-3-4-16-11/h3-7H,2H2,1H3,(H,15,17)(H,16,18,19) |
| InChIKey | NRZNQVDVSGSECU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|