C11H10FN5O — CID 107595556
N-(3-fluoro-4-pyridinyl)-5-hydrazinylpyridine-2-carboxamide (PubChem CID 107595556) has the molecular formula C11H10FN5O and a molecular weight of 247.23 g/mol. Its IUPAC name is N-(3-fluoro-4-pyridinyl)-5-hydrazinylpyridine-2-carboxamide.
| Compound Name | N-(3-fluoro-4-pyridinyl)-5-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 107595556 |
| Molecular Formula | C11H10FN5O |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-(3-fluoro-4-pyridinyl)-5-hydrazinylpyridine-2-carboxamide |
| SMILES | NNc1ccc(C(=O)Nc2ccncc2F)nc1 |
| InChI | InChI=1S/C11H10FN5O/c12-8-6-14-4-3-9(8)16-11(18)10-2-1-7(17-13)5-15-10/h1-6,17H,13H2,(H,14,16,18) |
| InChIKey | XUEIPYCPZFGBDG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|