C14H14Br2N2O2S — CID 107596340
3-amino-N-(2,6-dibromophenyl)-2,6-dimethylbenzenesulfonamide (PubChem CID 107596340) has the molecular formula C14H14Br2N2O2S and a molecular weight of 434.15 g/mol. Its IUPAC name is 3-amino-N-(2,6-dibromophenyl)-2,6-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(2,6-dibromophenyl)-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107596340 |
| Molecular Formula | C14H14Br2N2O2S |
| Molecular Weight | 434.15 g/mol |
| Exact Mass | 431.91 |
| IUPAC Name | 3-amino-N-(2,6-dibromophenyl)-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(N)c(C)c1S(=O)(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C14H14Br2N2O2S/c1-8-6-7-12(17)9(2)14(8)21(19,20)18-13-10(15)4-3-5-11(13)16/h3-7,18H,17H2,1-2H3 |
| InChIKey | QHRGJXFCAKOIBU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|