C14H14BrFN2O2 — CID 107596753
2-N-(2-bromo-6-fluorophenyl)-4,5-dimethoxybenzene-1,2-diamine (PubChem CID 107596753) has the molecular formula C14H14BrFN2O2 and a molecular weight of 341.18 g/mol. Its IUPAC name is 2-N-(2-bromo-6-fluorophenyl)-4,5-dimethoxybenzene-1,2-diamine.
| Compound Name | 2-N-(2-bromo-6-fluorophenyl)-4,5-dimethoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 107596753 |
| Molecular Formula | C14H14BrFN2O2 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2-N-(2-bromo-6-fluorophenyl)-4,5-dimethoxybenzene-1,2-diamine |
| SMILES | COc1cc(N)c(Nc2c(F)cccc2Br)cc1OC |
| InChI | InChI=1S/C14H14BrFN2O2/c1-19-12-6-10(17)11(7-13(12)20-2)18-14-8(15)4-3-5-9(14)16/h3-7,18H,17H2,1-2H3 |
| InChIKey | GKIZWVQZZIJECS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|