C12H12Br2N2S — CID 107597040
2,6-dibromo-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline (PubChem CID 107597040) has the molecular formula C12H12Br2N2S and a molecular weight of 376.12 g/mol. Its IUPAC name is 2,6-dibromo-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline.
| Compound Name | 2,6-dibromo-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107597040 |
| Molecular Formula | C12H12Br2N2S |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | 2,6-dibromo-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline |
| SMILES | Cc1ncsc1C(C)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H12Br2N2S/c1-7-12(17-6-15-7)8(2)16-11-9(13)4-3-5-10(11)14/h3-6,8,16H,1-2H3 |
| InChIKey | NVDYBFHMZYUXIW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |