C12H12BrIN2S — CID 114259232
5-bromo-2-iodo-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline (PubChem CID 114259232) has the molecular formula C12H12BrIN2S and a molecular weight of 423.12 g/mol. Its IUPAC name is 5-bromo-2-iodo-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline.
| Compound Name | 5-bromo-2-iodo-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 114259232 |
| Molecular Formula | C12H12BrIN2S |
| Molecular Weight | 423.12 g/mol |
| Exact Mass | 421.89 |
| IUPAC Name | 5-bromo-2-iodo-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline |
| SMILES | Cc1ncsc1C(C)Nc1cc(Br)ccc1I |
| InChI | InChI=1S/C12H12BrIN2S/c1-7-12(17-6-15-7)8(2)16-11-5-9(13)3-4-10(11)14/h3-6,8,16H,1-2H3 |
| InChIKey | LXGQIQCQHGPKID-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.12 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|