C13H10Br2FNO — CID 107597088
3-[(2,6-dibromoanilino)methyl]-5-fluorophenol (PubChem CID 107597088) has the molecular formula C13H10Br2FNO and a molecular weight of 375.04 g/mol. Its IUPAC name is 3-[(2,6-dibromoanilino)methyl]-5-fluorophenol.
| Compound Name | 3-[(2,6-dibromoanilino)methyl]-5-fluorophenol |
|---|---|
| PubChem CID | 107597088 |
| Molecular Formula | C13H10Br2FNO |
| Molecular Weight | 375.04 g/mol |
| Exact Mass | 372.91 |
| IUPAC Name | 3-[(2,6-dibromoanilino)methyl]-5-fluorophenol |
| SMILES | Oc1cc(F)cc(CNc2c(Br)cccc2Br)c1 |
| InChI | InChI=1S/C13H10Br2FNO/c14-11-2-1-3-12(15)13(11)17-7-8-4-9(16)6-10(18)5-8/h1-6,17-18H,7H2 |
| InChIKey | SBWGTTPFSSZHIA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.04 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |