C13H17Br2N — CID 107597104
2,6-dibromo-N-(2-methylcyclohexyl)aniline (PubChem CID 107597104) has the molecular formula C13H17Br2N and a molecular weight of 347.09 g/mol. Its IUPAC name is 2,6-dibromo-N-(2-methylcyclohexyl)aniline.
| Compound Name | 2,6-dibromo-N-(2-methylcyclohexyl)aniline |
|---|---|
| PubChem CID | 107597104 |
| Molecular Formula | C13H17Br2N |
| Molecular Weight | 347.09 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 2,6-dibromo-N-(2-methylcyclohexyl)aniline |
| SMILES | CC1CCCCC1Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C13H17Br2N/c1-9-5-2-3-8-12(9)16-13-10(14)6-4-7-11(13)15/h4,6-7,9,12,16H,2-3,5,8H2,1H3 |
| InChIKey | TUBJUHHPNXCZFD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.09 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |