C26H29N3O2S — CID 1075975
4-benzhydryl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 1075975) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is 4-benzhydryl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-benzhydryl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1075975 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 4-benzhydryl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H29N3O2S/c1-30-22-13-14-23(24(19-22)31-2)27-26(32)29-17-15-28(16-18-29)25(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-14,19,25H,15-18H2,1-2H3,(H,27,32) |
| InChIKey | NJFAWKDEUTVGFG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|