C27H30N2O3S — CID 2945630
N-(3,5-dimethoxyphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide (PubChem CID 2945630) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2945630 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C27H30N2O3S/c1-31-24-17-23(18-25(19-24)32-2)28-26(33)29-15-13-22(14-16-29)27(30,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,17-19,22,30H,13-16H2,1-2H3,(H,28,33) |
| InChIKey | AMGLNOKKFMMSAK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|