C18H29N3O2S — CID 1077071
1-(3,5-dimethoxyphenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 1077071) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 1077071 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | COc1cc(NC(=S)NC2CC(C)(C)NC(C)(C)C2)cc(OC)c1 |
| InChI | InChI=1S/C18H29N3O2S/c1-17(2)10-13(11-18(3,4)21-17)20-16(24)19-12-7-14(22-5)9-15(8-12)23-6/h7-9,13,21H,10-11H2,1-6H3,(H2,19,20,24) |
| InChIKey | QMOZLXZWZKHPOG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|