C17H30O5Si — CID 10759755
[(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-2-yl] 2,2-dimethylpropanoate (PubChem CID 10759755) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is [(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10759755 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C=CC(=O)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C17H30O5Si/c1-16(2,3)15(19)22-14-10-9-12(18)13(21-14)11-20-23(7,8)17(4,5)6/h9-10,13-14H,11H2,1-8H3/t13-,14-/m0/s1 |
| InChIKey | UVTRIAYQUPIASJ-KBPBESRZSA-N |
| XLogP | 3.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|