C13H13BrFN3O2 — CID 107597882
2-bromo-N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-6-fluoroaniline (PubChem CID 107597882) has the molecular formula C13H13BrFN3O2 and a molecular weight of 342.17 g/mol. Its IUPAC name is 2-bromo-N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-6-fluoroaniline.
| Compound Name | 2-bromo-N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-6-fluoroaniline |
|---|---|
| PubChem CID | 107597882 |
| Molecular Formula | C13H13BrFN3O2 |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-bromo-N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-6-fluoroaniline |
| SMILES | COc1ncnc(OC)c1CNc1c(F)cccc1Br |
| InChI | InChI=1S/C13H13BrFN3O2/c1-19-12-8(13(20-2)18-7-17-12)6-16-11-9(14)4-3-5-10(11)15/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | XJFMZOZSAPYOQJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |