C17H22F3N3OS — CID 1075981
N-[[(2R)-oxolan-2-yl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 1075981) has the molecular formula C17H22F3N3OS and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1075981 |
| Molecular Formula | C17H22F3N3OS |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cccc(N2CCN(C(=S)NC[C@H]3CCCO3)CC2)c1 |
| InChI | InChI=1S/C17H22F3N3OS/c18-17(19,20)13-3-1-4-14(11-13)22-6-8-23(9-7-22)16(25)21-12-15-5-2-10-24-15/h1,3-4,11,15H,2,5-10,12H2,(H,21,25)/t15-/m1/s1 |
| InChIKey | GCEIBLLNWJRDPK-OAHLLOKOSA-N |
| XLogP | 2.88 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|