C12H18N4O3 — CID 107600048
5-(aminomethyl)-N-(4-methoxy-6-methylpyrimidin-2-yl)oxolane-2-carboxamide (PubChem CID 107600048) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(4-methoxy-6-methylpyrimidin-2-yl)oxolane-2-carboxamide.
| Compound Name | 5-(aminomethyl)-N-(4-methoxy-6-methylpyrimidin-2-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 107600048 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 5-(aminomethyl)-N-(4-methoxy-6-methylpyrimidin-2-yl)oxolane-2-carboxamide |
| SMILES | COc1cc(C)nc(NC(=O)C2CCC(CN)O2)n1 |
| InChI | InChI=1S/C12H18N4O3/c1-7-5-10(18-2)15-12(14-7)16-11(17)9-4-3-8(6-13)19-9/h5,8-9H,3-4,6,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | IJNMUFAZNXYUSG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |