C15H22N2O5 — CID 120782760
(2S,5R)-5-(aminomethyl)-N-(3,4,5-trimethoxyphenyl)oxolane-2-carboxamide (PubChem CID 120782760) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(3,4,5-trimethoxyphenyl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(3,4,5-trimethoxyphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120782760 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(3,4,5-trimethoxyphenyl)oxolane-2-carboxamide |
| SMILES | COc1cc(NC(=O)[C@@H]2CC[C@H](CN)O2)cc(OC)c1OC |
| InChI | InChI=1S/C15H22N2O5/c1-19-12-6-9(7-13(20-2)14(12)21-3)17-15(18)11-5-4-10(8-16)22-11/h6-7,10-11H,4-5,8,16H2,1-3H3,(H,17,18)/t10-,11+/m1/s1 |
| InChIKey | WJIWBGAWHHDUHA-MNOVXSKESA-N |
| XLogP | 1.16 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |