C11H10BrFN2O4 — CID 107600967
4-[(2-bromo-6-fluorophenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 107600967) has the molecular formula C11H10BrFN2O4 and a molecular weight of 333.11 g/mol. Its IUPAC name is 4-[(2-bromo-6-fluorophenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(2-bromo-6-fluorophenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107600967 |
| Molecular Formula | C11H10BrFN2O4 |
| Molecular Weight | 333.11 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 4-[(2-bromo-6-fluorophenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC(=O)Nc1c(F)cccc1Br |
| InChI | InChI=1S/C11H10BrFN2O4/c12-6-2-1-3-7(13)10(6)15-11(19)14-8(16)4-5-9(17)18/h1-3H,4-5H2,(H,17,18)(H2,14,15,16,19) |
| InChIKey | ZSNWKHTXSULYKP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.11 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |