C14H16BrFN2S — CID 107601465
N-(2-bromo-6-fluorophenyl)-3-thia-1-azaspiro[4.5]dec-1-en-2-amine (PubChem CID 107601465) has the molecular formula C14H16BrFN2S and a molecular weight of 343.27 g/mol. Its IUPAC name is N-(2-bromo-6-fluorophenyl)-3-thia-1-azaspiro[4.5]dec-1-en-2-amine.
| Compound Name | N-(2-bromo-6-fluorophenyl)-3-thia-1-azaspiro[4.5]dec-1-en-2-amine |
|---|---|
| PubChem CID | 107601465 |
| Molecular Formula | C14H16BrFN2S |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N-(2-bromo-6-fluorophenyl)-3-thia-1-azaspiro[4.5]dec-1-en-2-amine |
| SMILES | Fc1cccc(Br)c1NC1=NC2(CCCCC2)CS1 |
| InChI | InChI=1S/C14H16BrFN2S/c15-10-5-4-6-11(16)12(10)17-13-18-14(9-19-13)7-2-1-3-8-14/h4-6H,1-3,7-9H2,(H,17,18) |
| InChIKey | MLLYCBQOJAXBLY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |