C13H13BrCl2N2S — CID 107791726
N-(4-bromo-2,3-dichlorophenyl)-3-thia-1-azaspiro[4.4]non-1-en-2-amine (PubChem CID 107791726) has the molecular formula C13H13BrCl2N2S and a molecular weight of 380.14 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-3-thia-1-azaspiro[4.4]non-1-en-2-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-3-thia-1-azaspiro[4.4]non-1-en-2-amine |
|---|---|
| PubChem CID | 107791726 |
| Molecular Formula | C13H13BrCl2N2S |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-3-thia-1-azaspiro[4.4]non-1-en-2-amine |
| SMILES | Clc1c(Br)ccc(NC2=NC3(CCCC3)CS2)c1Cl |
| InChI | InChI=1S/C13H13BrCl2N2S/c14-8-3-4-9(11(16)10(8)15)17-12-18-13(7-19-12)5-1-2-6-13/h3-4H,1-2,5-7H2,(H,17,18) |
| InChIKey | MPPOLESGTVZFCQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|