C15H11Br2ClN2 — CID 107601483
2-(chloromethyl)-1-(2,6-dibromophenyl)-5-methylbenzimidazole (PubChem CID 107601483) has the molecular formula C15H11Br2ClN2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2,6-dibromophenyl)-5-methylbenzimidazole.
| Compound Name | 2-(chloromethyl)-1-(2,6-dibromophenyl)-5-methylbenzimidazole |
|---|---|
| PubChem CID | 107601483 |
| Molecular Formula | C15H11Br2ClN2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 411.90 |
| IUPAC Name | 2-(chloromethyl)-1-(2,6-dibromophenyl)-5-methylbenzimidazole |
| SMILES | Cc1ccc2c(c1)nc(CCl)n2-c1c(Br)cccc1Br |
| InChI | InChI=1S/C15H11Br2ClN2/c1-9-5-6-13-12(7-9)19-14(8-18)20(13)15-10(16)3-2-4-11(15)17/h2-7H,8H2,1H3 |
| InChIKey | RVUBFNJZHJNUIO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|