C14H7BrCl3FN2 — CID 107601575
1-(2-bromo-6-fluorophenyl)-5,6-dichloro-2-(chloromethyl)benzimidazole (PubChem CID 107601575) has the molecular formula C14H7BrCl3FN2 and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)-5,6-dichloro-2-(chloromethyl)benzimidazole.
| Compound Name | 1-(2-bromo-6-fluorophenyl)-5,6-dichloro-2-(chloromethyl)benzimidazole |
|---|---|
| PubChem CID | 107601575 |
| Molecular Formula | C14H7BrCl3FN2 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 405.88 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)-5,6-dichloro-2-(chloromethyl)benzimidazole |
| SMILES | Fc1cccc(Br)c1-n1c(CCl)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C14H7BrCl3FN2/c15-7-2-1-3-10(19)14(7)21-12-5-9(18)8(17)4-11(12)20-13(21)6-16/h1-5H,6H2 |
| InChIKey | NKAHWXTVXLGXAN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|