C12H16N6O2 — CID 107605336
4-amino-5-ethyl-N-(4-methoxy-6-methylpyrimidin-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 107605336) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-amino-5-ethyl-N-(4-methoxy-6-methylpyrimidin-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-ethyl-N-(4-methoxy-6-methylpyrimidin-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107605336 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-amino-5-ethyl-N-(4-methoxy-6-methylpyrimidin-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)Nc2nc(C)cc(OC)n2)c1N |
| InChI | InChI=1S/C12H16N6O2/c1-4-7-9(13)10(18-17-7)11(19)16-12-14-6(2)5-8(15-12)20-3/h5H,4,13H2,1-3H3,(H,17,18)(H,14,15,16,19) |
| InChIKey | NDYRXQIUDUDYRG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |